<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYB8PHr004</id>
		<title>Mol:BMFYB8PHr004 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYB8PHr004"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;action=history"/>
		<updated>2026-04-10T05:03:55Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177703&amp;oldid=prev</id>
		<title>Editor at 01:05, 17 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177703&amp;oldid=prev"/>
				<updated>2010-06-17T01:05:13Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 01:05, 17 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 87:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 87:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	586.3188270379999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	586.3188270379999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	586.6772020000001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	586.6772020000001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177702&amp;oldid=prev</id>
		<title>Editor at 01:05, 17 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177702&amp;oldid=prev"/>
				<updated>2010-06-17T01:05:04Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 01:05, 17 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 80:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 80:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 38&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 38&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 39&amp;#160; 2&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 39&amp;#160; 2&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;7 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;NAME	all-trans-Hexaprenyl diphosphate &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8PHr004 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8PHr004 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;NAME	[(2E,6E,10E,14E,18E) -3,7,11,15,19,23-Hexamethyltetracosa- 2,6,10,14,18,22-hexaenyl] phosphono hydrogen phosphate &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;CAS_RN	207513-95-9 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H52O7P2 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H52O7P2 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	586.3188270379999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	586.3188270379999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	586.6772020000001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	586.6772020000001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177701&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/   39 38  0     0  0            999 V2000      1.4913    1.4461    0.0000 C   0  0  0  0  0  0           0  0  0     17.0681    1.0655  ...</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8PHr004&amp;diff=177701&amp;oldid=prev"/>
				<updated>2009-03-19T06:19:27Z</updated>
		
		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/   39 38  0     0  0            999 V2000      1.4913    1.4461    0.0000 C   0  0  0  0  0  0           0  0  0     17.0681    1.0655  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 39 38  0     0  0            999 V2000 &lt;br /&gt;
    1.4913    1.4461    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   17.0681    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   17.8117    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   16.3244    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   17.8117    2.2363    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.0852    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.8289    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   13.3374    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   15.5767    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.8289    2.2363    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.0982    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.8501    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   10.3587    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   12.5938    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.8501    2.2363    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    8.1195    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    8.8631    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    7.3717    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.6067    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    8.8631    2.2363    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    5.1407    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    5.8844    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    4.3971    1.4530    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    6.6281    1.0655    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    5.8844    2.2363    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    2.1983    1.0670    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    2.9214    1.4461    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    3.6401    1.0670    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    2.9214    2.1967    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   18.5583    1.0667    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    0.6653    0.9944    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -0.1535    0.9966    0.0000 P   0  0  3  0  0  0           0  0  0 &lt;br /&gt;
   -0.9693    0.9931    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -0.1500    1.8193    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -0.1569    0.1773    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -1.7885    0.9966    0.0000 P   0  0  3  0  0  0           0  0  0 &lt;br /&gt;
   -2.6078    0.9966    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -1.7885    1.8193    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   -1.7919    0.1773    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
 19 13  1  0     0  0 &lt;br /&gt;
 21 22  2  0     0  0 &lt;br /&gt;
 21 23  1  0     0  0 &lt;br /&gt;
 22 24  1  0     0  0 &lt;br /&gt;
 22 25  1  0     0  0 &lt;br /&gt;
 24 18  1  0     0  0 &lt;br /&gt;
  2  3  2  0     0  0 &lt;br /&gt;
  1 26  1  0     0  0 &lt;br /&gt;
 26 27  2  0     0  0 &lt;br /&gt;
 27 28  1  0     0  0 &lt;br /&gt;
 27 29  1  0     0  0 &lt;br /&gt;
 28 23  1  0     0  0 &lt;br /&gt;
  2  4  1  0     0  0 &lt;br /&gt;
  3 30  1  0     0  0 &lt;br /&gt;
  3  5  1  0     0  0 &lt;br /&gt;
  6  7  2  0     0  0 &lt;br /&gt;
  6  8  1  0     0  0 &lt;br /&gt;
  7  9  1  0     0  0 &lt;br /&gt;
  7 10  1  0     0  0 &lt;br /&gt;
  9  4  1  0     0  0 &lt;br /&gt;
 11 12  2  0     0  0 &lt;br /&gt;
  1 31  1  0     0  0 &lt;br /&gt;
 11 13  1  0     0  0 &lt;br /&gt;
 12 14  1  0     0  0 &lt;br /&gt;
 12 15  1  0     0  0 &lt;br /&gt;
 14  8  1  0     0  0 &lt;br /&gt;
 16 17  2  0     0  0 &lt;br /&gt;
 16 18  1  0     0  0 &lt;br /&gt;
 17 19  1  0     0  0 &lt;br /&gt;
 17 20  1  0     0  0 &lt;br /&gt;
 31 32  1  0     0  0 &lt;br /&gt;
 32 33  1  0     0  0 &lt;br /&gt;
 32 34  1  0     0  0 &lt;br /&gt;
 32 35  2  0     0  0 &lt;br /&gt;
 33 36  1  0     0  0 &lt;br /&gt;
 36 37  1  0     0  0 &lt;br /&gt;
 36 38  1  0     0  0 &lt;br /&gt;
 36 39  2  0     0  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
NAME	all-trans-Hexaprenyl diphosphate &lt;br /&gt;
ID	BMFYB8PHr004 &lt;br /&gt;
FORMULA	C30H52O7P2 &lt;br /&gt;
EXACTMASS	586.3188270379999 &lt;br /&gt;
AVERAGEMASS	586.6772020000001 &lt;br /&gt;
SMILES	OP(O)(=O)OP(O)(=O)OCC=C(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>