<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMMCBZ3Ss060</id>
		<title>Mol:BMMCBZ3Ss060 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMMCBZ3Ss060"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMMCBZ3Ss060&amp;action=history"/>
		<updated>2026-07-22T13:19:05Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMMCBZ3Ss060&amp;diff=179162&amp;oldid=prev</id>
		<title>Editor at 07:17, 17 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMMCBZ3Ss060&amp;diff=179162&amp;oldid=prev"/>
				<updated>2010-06-17T07:17:01Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 07:17, 17 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 81:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 81:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 37&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 36 37&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 31 22&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 31 22&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;7 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	2-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;Hexaprenyl&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;6&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;methoxy&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;1&lt;/del&gt;,&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;4&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;benzoquinone &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	2- &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;[(2E,6E,10E,14E,18E) &lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;3,7,11,15,19,23&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;Hexamethyltetracosa&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;2&lt;/ins&gt;,&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;6,10,14,18,22&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;hexaenyl] -6-methoxyphenol &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;CAS_RN	65848-02-4 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMMCBZ3Ss060 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMMCBZ3Ss060 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C37H56O2 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C37H56O2 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	532.428031036 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	532.428031036 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	532.83934 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	532.83934 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	C(C=C(C)C)CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCc(c1)c(O)c(cc1)OC)C)C)C)C &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C=C(C)C)CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCc(c1)c(O)c(cc1)OC)C)C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C=C(C)C)CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCc(c1)c(O)c(cc1)OC)C)C)C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMMCBZ3Ss060&amp;diff=179161&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/   39 39  0     0  0            999 V2000     21.9721   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0     22.6949   -8.1732  ...</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMMCBZ3Ss060&amp;diff=179161&amp;oldid=prev"/>
				<updated>2009-03-19T06:30:36Z</updated>
		
		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/   39 39  0     0  0            999 V2000     21.9721   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0     22.6949   -8.1732  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 39 39  0     0  0            999 V2000 &lt;br /&gt;
   21.9721   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   22.6949   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   23.4177   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   24.1363   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   23.4177   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   24.8591   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   19.0850   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   19.8078   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   20.5306   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   21.2493   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   20.5306   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   16.2008   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   16.9236   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   17.6464   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   18.3650   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   17.6464   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   13.3137   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.0365   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.7593   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   15.4780   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   14.7593   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   10.4267   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.1495   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.8723   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   12.5909   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   11.8723   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   25.5819   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   26.3047   -8.5898    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   27.0234   -8.1732    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
   26.3047   -9.4232    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.7017   -8.1770    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.0155   -8.5846    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.7017   -7.3694    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    8.3079   -8.1770    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.0155   -9.3922    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    9.0155   -6.9659    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    8.3079   -7.3694    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    7.5858   -8.5915    0.0000 O   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
    6.8720   -8.1736    0.0000 C   0  0  0  0  0  0           0  0  0 &lt;br /&gt;
  9 11  1  0     0  0 &lt;br /&gt;
 19 21  1  0     0  0 &lt;br /&gt;
 20 12  1  0     0  0 &lt;br /&gt;
 10  1  1  0     0  0 &lt;br /&gt;
  4  6  1  0     0  0 &lt;br /&gt;
 22 23  1  0     0  0 &lt;br /&gt;
  1  2  1  0     0  0 &lt;br /&gt;
 23 24  2  0     0  0 &lt;br /&gt;
 12 13  1  0     0  0 &lt;br /&gt;
 24 25  1  0     0  0 &lt;br /&gt;
  3  4  1  0     0  0 &lt;br /&gt;
 24 26  1  0     0  0 &lt;br /&gt;
 25 17  1  0     0  0 &lt;br /&gt;
 13 14  2  0     0  0 &lt;br /&gt;
  6 27  1  0     0  0 &lt;br /&gt;
  7  8  1  0     0  0 &lt;br /&gt;
 27 28  2  0     0  0 &lt;br /&gt;
 14 15  1  0     0  0 &lt;br /&gt;
 28 29  1  0     0  0 &lt;br /&gt;
 28 30  1  0     0  0 &lt;br /&gt;
 14 16  1  0     0  0 &lt;br /&gt;
 15  7  1  0     0  0 &lt;br /&gt;
  8  9  2  0     0  0 &lt;br /&gt;
  3  5  1  0     0  0 &lt;br /&gt;
 17 18  1  0     0  0 &lt;br /&gt;
  9 10  1  0     0  0 &lt;br /&gt;
 18 19  2  0     0  0 &lt;br /&gt;
  2  3  2  0     0  0 &lt;br /&gt;
 19 20  1  0     0  0 &lt;br /&gt;
 31 32  2  0     0  0 &lt;br /&gt;
 31 33  1  0     0  0 &lt;br /&gt;
 32 34  1  0     0  0 &lt;br /&gt;
 32 35  1  0     0  0 &lt;br /&gt;
 33 36  2  0     0  0 &lt;br /&gt;
 34 37  2  0     0  0 &lt;br /&gt;
 34 38  1  0     0  0 &lt;br /&gt;
 38 39  1  0     0  0 &lt;br /&gt;
 36 37  1  0     0  0 &lt;br /&gt;
 31 22  1  0     0  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
NAME	2-Hexaprenyl-6-methoxy-1,4-benzoquinone &lt;br /&gt;
ID	BMMCBZ3Ss060 &lt;br /&gt;
FORMULA	C37H56O2 &lt;br /&gt;
EXACTMASS	532.428031036 &lt;br /&gt;
AVERAGEMASS	532.83934 &lt;br /&gt;
SMILES	C(C=C(C)C)CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCc(c1)c(O)c(cc1)OC)C)C)C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>