FLIACANI0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Gancaonin G | + | |SysName=Gancaonin G |
|Common Name=&&Gancaonin G&&5,4'-Dihydroxy-7-methoxy-6-prenylisoflavone&& | |Common Name=&&Gancaonin G&&5,4'-Dihydroxy-7-methoxy-6-prenylisoflavone&& | ||
|CAS=126716-34-5 | |CAS=126716-34-5 | ||
|KNApSAcK=C00009888 | |KNApSAcK=C00009888 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 126716-34-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIACANI0001.mol |
Gancaonin G | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Gancaonin G |
Common Name |
|
Symbol | |
Formula | C21H20O5 |
Exact Mass | 352.13107375 |
Average Mass | 352.3805 |
SMILES | COc(c(CC=C(C)C)3)cc(c(c3O)2)OC=C(C2=O)c(c1)ccc(O)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|