FLIADCNI0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Glabrescione B | + | |SysName=Glabrescione B |
|Common Name=&&Glabrescione B&&5,7-Dimethoxy-3',4'-diprenyloxyisoflavone&& | |Common Name=&&Glabrescione B&&5,7-Dimethoxy-3',4'-diprenyloxyisoflavone&& | ||
|CAS=65893-94-9 | |CAS=65893-94-9 | ||
|KNApSAcK=C00009528 | |KNApSAcK=C00009528 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 65893-94-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIADCNI0001.mol |
Glabrescione B | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Glabrescione B |
Common Name |
|
Symbol | |
Formula | C27H30O6 |
Exact Mass | 450.204238692 |
Average Mass | 450.5235 |
SMILES | C(C)(C)=CCOc(c3OCC=C(C)C)ccc(c3)C(=C1)C(=O)c(c2OC) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|