FLIB1LNS0010
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=7-Hydroxy-2',3',4'-trimethoxyisoflavanone |
|Common Name=&&3'-O-Methylviolanone&&7-Hydroxy-2',3',4'-trimethoxyisoflavanone&& | |Common Name=&&3'-O-Methylviolanone&&7-Hydroxy-2',3',4'-trimethoxyisoflavanone&& | ||
|CAS=56973-42-3 | |CAS=56973-42-3 | ||
|KNApSAcK=C00009545 | |KNApSAcK=C00009545 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 56973-42-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIB1LNS0010.mol |
| 3'-O-Methylviolanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C18H18O6 |
| Exact Mass | 330.110338308 |
| Average Mass | 330.33191999999997 |
| SMILES | c(c3OC)(OC)ccc(c3OC)C(C2=O)COc(c21)cc(O)cc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
