LBF12110BC01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7106 | |LipidBank=DFA7106 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7106 |
LipidMaps | LMFA01020138 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF12110BC01.mol |
![]() | |
Structural Information | |
Systematic Name | 4-Heptyl-2-Methyl-2-Undecenoic Acid |
Common Name | |
Symbol | |
Formula | C19H36O2 |
Exact Mass | 296.271530396 |
Average Mass | 296.48794000000004 |
SMILES | CCCCCCCC(CCCCCCC)C=C(C)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | 183 - 184°C/0.5mmHg <<7102>> |
Density | |
Optical Rotation | h25/D = 1.4643 <<7102>> |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax 219nm (emax 13,800) <<7102>> |
IR Spectra | C=CH: 9.91, 12.42, 13.29, 15.01m <<7102>> |
NMR Spectra | |
Chromatograms |