LBF18000BC04
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7017 | |LipidBank=DFA7017 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7017 |
LipidMaps | LMFA01020049 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18000BC04.mol |
![]() | |
Structural Information | |
Systematic Name | 4,14-Dimethyloctadecanoic Acid |
Common Name | |
Symbol | |
Formula | C20H40O2 |
Exact Mass | 312.302830524 |
Average Mass | 312.53040000000004 |
SMILES | C(CC(CCCCCCCCCC(CCC(O)=O)C)C)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |