LBF18207SC03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0157 | |LipidBank=DFA0157 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0157 |
LipidMaps | LMFA01030118 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18207SC03.mol |
![]() | |
Structural Information | |
Systematic Name | cis-9, trans-11-Octadecadienoic acid |
Common Name | |
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCCC=CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | -6°C to -3°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0377>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |