LBF20406AM07
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7023 | |LipidBank=XPR7023 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7023 |
LipidMaps | LMFA08020009 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM07.mol |
![]() | |
Structural Information | |
Systematic Name | N-propylarachidonoyl amide |
Common Name | |
Symbol | |
Formula | C23H39NO |
Exact Mass | 345.303164875 |
Average Mass | 345.5619 |
SMILES | C(CCC(=O)NCCC)C=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.62 (br s, 1H), 5.26-5.38 (m, 8H), 3.13 (q, J=6Hz, 2H), 2.62-2.80 (m, 6H), 2.10 (t, J=7.3Hz, 2H), 1.96-2.06 (m, 4H), 1.56-1.66 (m, 2H), 1,38-1.48 (m, 2H), 1.20-1.32 (m, 6H), 0.79-0.86 (m, 6H) <<7001>> |
Chromatograms |