LBF20406AM13
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7029 | |LipidBank=XPR7029 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7029 |
LipidMaps | LMFA08020015 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM13.mol |
![]() | |
Structural Information | |
Systematic Name | N- (1,1-dimethylpropyl) arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | C(NC(C)(C)CC)(=O)CCCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.28-5.38 (m, 8H), 5.10 (br s, lH), 2.67-2.82 (m, 6H), 2.04-2.12 (m, 6H), 1.66-1.76 (m, 4H), 1.24-1.32 (m, l2 H), 0.81-0.90 (m, 6H). <<7001>> |
Chromatograms |