LBF20406AM20
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7036 | |LipidBank=XPR7036 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7036 |
LipidMaps | LMFA08020022 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM20.mol |
Structural Information | |
---|---|
Systematic Name | N'-arachidonoyl-N"-diethylethylenediamine |
Common Name | |
Symbol | |
Formula | C26H44N2O |
Exact Mass | 400.34536404 |
Average Mass | 400.64043999999996 |
SMILES | C(CCC)CC=CCC=CCC=CCC=CCCCC(=O)NC=CN(CC)CC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d6.10 (br s lH), 5.26-5.42 (m, 8H), 3.22-3.30 (m, 2H), 2.76-2.90 (m, 6H), 2.50-2.62 (m, 6H), 1.66-1.80 (m, 2H), 1.20-1.40 (m, 6H), 1.02 (t, J=7.1Hz, 6H), 0.89 (t, J=6.5Hz, 3H). <<7001>> |
Chromatograms |