LBF20406AM30
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7047 | |LipidBank=XPR7047 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7047 |
LipidMaps | LMFA08020033 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM30.mol |
Structural Information | |
---|---|
Systematic Name | N-propyl alpha-methyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO |
Exact Mass | 359.318814939 |
Average Mass | 359.58847999999995 |
SMILES | C(C=CCCC(C)C(=O)NCCC)C=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.20-5.45 (m, |
Chromatograms |