LBF20406AM37
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7054 | |LipidBank=XPR7054 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7054 |
| LipidMaps | LMFA08020040 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM37.mol |
| |
| Structural Information | |
| Systematic Name | N- (1-methyl-2-hydroxyethyl) arachidonoylamide (R) |
| Common Name | |
| Symbol | |
| Formula | C23H39NO2 |
| Exact Mass | 361.298079497 |
| Average Mass | 361.5613 |
| SMILES | C(CCC(=O)N[C@@H](CO)C)C=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless liquid <<7012>. |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | dX425= +10.9° <<7012>> |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (200 MHz, CDCl3) d(TMS)5.57 (m, 1H), 5.47-5.30 (m, 8H), 4.14-4.02 (m, 1H), 3.71-3.48 (m, 2H), 2.84-2.81 (m, 6H), 2.24-2.01 (m, 6H), 1.77-1.65 (m, 2H), 1.39-1.26 (m, 6H), 1.17 (d, J=3.46Hz, 3H), 0.89 (t, J=6.12Hz, 3H) <<7012>> |
| Chromatograms | Rf 0.3(5% MeOH/CHCl3) <<0012>> |
