LBF20406HO07
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8102 | |LipidBank=DFA8102 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8102 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO07.mol |
Structural Information | |
---|---|
Systematic Name | 5S,6R-dihydroxy-7E,9E,11Z,14Z-eicosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O4 |
Exact Mass | 336.23005951199997 |
Average Mass | 336.46567999999996 |
SMILES | C(CC=CCC=CC=CC=C[C@@H](O)[C@@H](O)CCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | Soluble in ethanol. |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax:273nm e:40,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |