LBF21307PG03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1745 | |LipidBank=XPR1745 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR1745 |
LipidMaps | LMFA03010063 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF21307PG03.mol |
15 (R) -15-methyl Prostaglandin E2 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9-oxo-11alpha,15R-dihydroxy-15-methyl-prosta-5Z,13E-dien-1-oic acid |
Common Name |
|
Symbol | |
Formula | C21H34O5 |
Exact Mass | 366.240624198 |
Average Mass | 366.49166 |
SMILES | C(=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](CC1=O)O)[C@@] |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |