BMAXS5ANk006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=N2-(D-1-Carboxy-ethyl)-L-arginine | + | |SysName=N2- (D-1-Carboxy-ethyl) -L-arginine |
| − | |Common Name=&&N2-(D-1-Carboxyethyl)-L-arginine&&D-Octopine&&N2-(1-Carboxyethyl)-L-arginine&& | + | |Common Name=&&N2- (D-1-Carboxyethyl) -L-arginine&&D-Octopine&&N2- (1-Carboxyethyl) -L-arginine&& |
|CAS=34522-32-2 | |CAS=34522-32-2 | ||
|KEGG=C04137 | |KEGG=C04137 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 34522-32-2 |
| KEGG | C04137 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXS5ANk006.mol |
| N2- (D-1-Carboxyethyl) -L-arginine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | N2- (D-1-Carboxy-ethyl) -L-arginine |
| Common Name |
|
| Symbol | |
| Formula | C9H18N4O4 |
| Exact Mass | 246.1328 |
| Average Mass | 246.2637 |
| SMILES | NC(=N)NCCC[C@H](N[C@@H](C)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
