BMFYB3CAe012
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 18416-85-8 |
| KEGG | C01726 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB3CAe012.mol |
| D-Lombricine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Lombricine |
| Common Name |
|
| Symbol | |
| Formula | C6H15N4O6P |
| Exact Mass | 270.0729 |
| Average Mass | 270.1804 |
| SMILES | NC(=N)NCCOP(O)(=O)OC[C@@H](N)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
