BMMCAS--l016
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 65646-26-6 |
KEGG | C02717 |
KNApSAcK | |
CDX file | |
MOL file | BMMCAS--l016.mol |
![]() | |
Structural Information | |
Systematic Name | N-Feruloyl-tyramine |
Common Name | |
Symbol | |
Formula | C18H19NO4 |
Exact Mass | 313.1314 |
Average Mass | 313.3478 |
SMILES | COc(c1)c(O)ccc(C=CC(=O)NCCc(c2)ccc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |