BMMCBZ3Sj023
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=3,4-Dihydroxy-phenyl-pyruvic acid | |SysName=3,4-Dihydroxy-phenyl-pyruvic acid | ||
|Common Name=&&3-(3,4-Dihydroxyphenyl)pyruvate&& | |Common Name=&&3-(3,4-Dihydroxyphenyl)pyruvate&& | ||
| − | |CAS= | + | |CAS=4228-66-4 |
|KEGG=C04045 | |KEGG=C04045 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4228-66-4 |
| KEGG | C04045 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ3Sj023.mol |
| 3-(3,4-Dihydroxyphenyl)pyruvate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4-Dihydroxy-phenyl-pyruvic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H8O5 |
| Exact Mass | 196.0371 |
| Average Mass | 196.1568 |
| SMILES | OC(=O)C(=O)Cc(c1)cc(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
