BMMCIZ--e016
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=D-erythro-Imidazole-glycerol phosphate | |SysName=D-erythro-Imidazole-glycerol phosphate | ||
| − | |Common Name=&&D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate&&D-erythro-Imidazole-glycerol 3-phosphate&&D-erythro-Imidazole-glycerol phosphate&& | + | |Common Name=&&D-erythro-1- (Imidazol-4-yl) glycerol 3-phosphate&&D-erythro-Imidazole-glycerol 3-phosphate&&D-erythro-Imidazole-glycerol phosphate&& |
|CAS=? | |CAS=? | ||
|KEGG=C04666 | |KEGG=C04666 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04666 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCIZ--e016.mol |
| D-erythro-1- (Imidazol-4-yl) glycerol 3-phosphate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | D-erythro-Imidazole-glycerol phosphate |
| Common Name |
|
| Symbol | |
| Formula | C6H11N2O6P |
| Exact Mass | 238.0354 |
| Average Mass | 238.1351 |
| SMILES | O[C@@H](COP(O)(O)=O)[C@H](O)c(c1)ncn1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
