Beta-Eudesmol
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2R,4aR,8aS)-Decahydro- | + | |SysName=(2R,4aR,8aS)-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol |
− | |Common Name=&& | + | |Common Name=&&beta-Eudesmol&&1,2alpha,3,4,4a,5,6,7,8,8aalpha-Decahydro-alpha,alpha,4abeta-trimethyl-8-methylene-2-naphthalenemethanol&&[2R-(2alpha,4aalpha,8abeta)]-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol&&Eudesm-4(14)-en-11-ol&&(+)-beta-Eudesmol&&beta-Selinenol&& |
|CAS=473-15-4 | |CAS=473-15-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} |
Latest revision as of 12:27, 19 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 473-15-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Beta-Eudesmol.mol |
beta-Eudesmol | |
---|---|
Structural Information | |
Systematic Name | (2R,4aR,8aS)-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol |
Common Name |
|
Symbol | |
Formula | C15H26O |
Exact Mass | 222.198365454 |
Average Mass | 222.36634 |
SMILES | CC(C)(O)C(C1)CC([H])(C(=C)2)C(C)(CCC2)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |