FL1CG9NS0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(E)-1-(Pentamethoxyphenyl)-3-phenyl-2-propen-1-one | + | |SysName=(E)-1-(Pentamethoxyphenyl)-3-phenyl-2-propen-1-one |
− | |Common Name=&&Pedicellin && | + | |Common Name=&&Pedicellin&&(E)-1-(Pentamethoxyphenyl)-3-phenyl-2-propen-1-one&& |
|CAS=518-58-1 | |CAS=518-58-1 | ||
|KNApSAcK=C00006986 | |KNApSAcK=C00006986 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 518-58-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CG9NS0005.mol |
Pedicellin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (E)-1-(Pentamethoxyphenyl)-3-phenyl-2-propen-1-one |
Common Name |
|
Symbol | |
Formula | C20H22O6 |
Exact Mass | 358.141638436 |
Average Mass | 358.38508 |
SMILES | O(C)c(c2OC)c(c(OC)c(c2OC)OC)C(=O)C=Cc(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|