FL1D1ANI0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3-(4-Hydroxyphenyl)-1-[2,4-dihydroxy-3-(2,3-dihydroxy-3-methylbutyl)phenyl]propane-1-one | + | |SysName=3- (4-Hydroxyphenyl) -1- [ 2,4-dihydroxy-3- (2,3-dihydroxy-3-methylbutyl) phenyl ] propane-1-one |
− | |Common Name=&&Brosimacutin H&&3-(4-Hydroxyphenyl)-1-[2,4-dihydroxy-3-(2,3-dihydroxy-3-methylbutyl)phenyl]propane-1-one&& | + | |Common Name=&&Brosimacutin H&&3- (4-Hydroxyphenyl) -1- [ 2,4-dihydroxy-3- (2,3-dihydroxy-3-methylbutyl) phenyl ] propane-1-one&& |
|CAS=350221-45-3 | |CAS=350221-45-3 | ||
|KNApSAcK=C00011119 | |KNApSAcK=C00011119 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 350221-45-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1D1ANI0003.mol |
Brosimacutin H | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3- (4-Hydroxyphenyl) -1- [ 2,4-dihydroxy-3- (2,3-dihydroxy-3-methylbutyl) phenyl ] propane-1-one |
Common Name |
|
Symbol | |
Formula | C20H24O6 |
Exact Mass | 360.1572885 |
Average Mass | 360.40096 |
SMILES | c(c2O)(ccc(c2CC(O)C(C)(C)O)O)C(=O)CCc(c1)ccc(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|