FL1DA9NI0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2',6'-Dihydroxy-4'-methoxy-3'-prenyldihydrochalcone |
|Common Name=&&2',6'-Dihydroxy-4'-methoxy-3'-prenyldihydrochalcone&& | |Common Name=&&2',6'-Dihydroxy-4'-methoxy-3'-prenyldihydrochalcone&& | ||
|CAS=85526-72-3 | |CAS=85526-72-3 | ||
|KNApSAcK=C00008005 | |KNApSAcK=C00008005 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 85526-72-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1DA9NI0002.mol |
2',6'-Dihydroxy-4'-methoxy-3'-prenyldihydrochalcone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C21H24O4 |
Exact Mass | 340.167459256 |
Average Mass | 340.41285999999997 |
SMILES | C(c(c1O)c(cc(c1C(=O)CCc(c2)cccc2)O)OC)C=C(C)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|