FL2F19NS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=7-Hydroxyflavanone |
|Common Name=&&7-Hydroxyflavanone&& | |Common Name=&&7-Hydroxyflavanone&& | ||
|CAS=6515-36-2 | |CAS=6515-36-2 | ||
|KNApSAcK=C00008126 | |KNApSAcK=C00008126 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 6515-36-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2F19NS0001.mol |
7-Hydroxyflavanone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 7-Hydroxyflavanone |
Common Name |
|
Symbol | |
Formula | C15H12O3 |
Exact Mass | 240.07864425 |
Average Mass | 240.25398 |
SMILES | Oc(c3)cc(O1)c(c3)C(=O)CC1c(c2)cccc2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|