FL2FA8NS0005
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,7,2'-Trihydroxyflavanone |
|Common Name=&&5,7,2'-Trihydroxyflavanone&& | |Common Name=&&5,7,2'-Trihydroxyflavanone&& | ||
|CAS=111199-94-1 | |CAS=111199-94-1 | ||
|KNApSAcK=C00008478 | |KNApSAcK=C00008478 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FA8 5,7,2',(3'),(5'),(6')-Hydroxyflavanone and O-methyl derivatives (25 pages) : FL2FA8NS Simple substitution (10 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 111199-94-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA8NS0005.mol |
| 5,7,2'-Trihydroxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,2'-Trihydroxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O5 |
| Exact Mass | 272.068473494 |
| Average Mass | 272.25278000000003 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)CC1c(c2)c(O)ccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
