FL2FECNS0004
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=6-Hydroxy-5,7-dimethoxy-3',4'-methylenedioxyflavanone | |SysName=6-Hydroxy-5,7-dimethoxy-3',4'-methylenedioxyflavanone | ||
− | |Common Name=&&Agestricin B&& | + | |Common Name=&&Agestricin B&&6-Hydroxy-5,7-dimethoxy-3',4'-methylenedioxyflavanone&& |
|CAS=85563-74-2 | |CAS=85563-74-2 | ||
|KNApSAcK=C00008311 | |KNApSAcK=C00008311 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 85563-74-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2FECNS0004.mol |
Agestricin B | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6-Hydroxy-5,7-dimethoxy-3',4'-methylenedioxyflavanone |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(c41)(OCO4)ccc(C(O2)CC(c(c3OC)c2cc(c3O)OC)=O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|