FL3F2GNS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=6,7,3',4',5'-Pentamethoxyflavone | |SysName=6,7,3',4',5'-Pentamethoxyflavone | ||
| − | |Common Name=&&Prosogerin C&& | + | |Common Name=&&Prosogerin C&&6,7,3',4',5'-Pentamethoxyflavone&& |
|CAS=70793-62-3 | |CAS=70793-62-3 | ||
|KNApSAcK=C00003921 | |KNApSAcK=C00003921 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70793-62-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F2GNS0003.mol |
| Prosogerin C | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7,3',4',5'-Pentamethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O7 |
| Exact Mass | 372.120902994 |
| Average Mass | 372.3686 |
| SMILES | COc(c1OC)c(cc(C(=C3)Oc(c2C(=O)3)cc(OC)c(c2)OC)c1)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
