FL3FFANS0002
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |Sysname=5,8,4'-Trihydroxy-7-methoxyflavone  | 
|Common Name=&&Isocutellarein 7-methyl ether&&5,8,4'-Trihydroxy-7-methoxyflavone&&  | |Common Name=&&Isocutellarein 7-methyl ether&&5,8,4'-Trihydroxy-7-methoxyflavone&&  | ||
|CAS=56595-23-4  | |CAS=56595-23-4  | ||
|KNApSAcK=C00003849  | |KNApSAcK=C00003849  | ||
}}  | }}  | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 56595-23-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FFANS0002.mol | 
| Isocutellarein 7-methyl ether | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | |
| Common Name | 
  | 
| Symbol | |
| Formula | C16H12O6 | 
| Exact Mass | 300.063388116 | 
| Average Mass | 300.26288 | 
| SMILES | COc(c3)c(O)c(O1)c(c(O)3)C(=O)C=C(c(c2)ccc(O)c2)1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
