FL4D3CNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=(2R,3R)-3,7,3',4',8'-Pentahydroxyflavanone |
|Common Name=&&8-Hydroxyfustin&& | |Common Name=&&8-Hydroxyfustin&& | ||
|CAS=38081-18-4 | |CAS=38081-18-4 | ||
|KNApSAcK=C00008583 | |KNApSAcK=C00008583 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 38081-18-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4D3CNS0001.mol |
8-Hydroxyfustin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C15H12O7 |
Exact Mass | 304.058302738 |
Average Mass | 304.25158 |
SMILES | Oc(c3)c(O)cc(c3)C(O1)C(O)C(=O)c(c2)c1c(O)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|