FL5F19NP0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Karanjachromene | + | |SysName=Karanjachromene |
|Common Name=&&Karanjachromene&&Pongaflavone&&3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one&& | |Common Name=&&Karanjachromene&&Pongaflavone&&3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one&& | ||
|CAS=38070-93-8 | |CAS=38070-93-8 | ||
|KNApSAcK=C00005072 | |KNApSAcK=C00005072 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38070-93-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F19NP0001.mol |
| Karanjachromene | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Karanjachromene |
| Common Name |
|
| Symbol | |
| Formula | C21H18O4 |
| Exact Mass | 334.120509064 |
| Average Mass | 334.36521999999997 |
| SMILES | COC(C(=O)2)=C(Oc(c34)c2ccc(OC(C=C4)(C)C)3)c(c1)ccc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
