FL5FAANI0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Licoflavonol&&3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Licoflavonol&&3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=60197-60-6 | |CAS=60197-60-6 | ||
|KNApSAcK=C00004993 | |KNApSAcK=C00004993 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAANI Non-cyclic prenyl substituted (10 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 60197-60-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAANI0001.mol |
| Licoflavonol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O6 |
| Exact Mass | 354.110338308 |
| Average Mass | 354.35332 |
| SMILES | c(c3)c(ccc(O)3)C(=C2O)Oc(c1C2=O)cc(c(CC=C(C)C)c1O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
