FL5FALNS0003
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=3,5,7,2'-Tetrahydroxy-4'-methoxyflavone | 
| |Common Name=&&Milimorin&& | |Common Name=&&Milimorin&& | ||
| |CAS=95065-10-4 | |CAS=95065-10-4 | ||
| |KNApSAcK=C00004625 | |KNApSAcK=C00004625 | ||
| }} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 95065-10-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FALNS0003.mol | 
| Milimorin | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | |
| Common Name | 
 | 
| Symbol | |
| Formula | C16H12O7 | 
| Exact Mass | 316.058302738 | 
| Average Mass | 316.26228000000003 | 
| SMILES | COc(c3)cc(O)c(c3)C(O1)=C(O)C(=O)c(c(O)2)c(cc(O)c2) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
