FL5FDKNS0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,7,5'-Trihydroxy-3,3',4'-trimethoxyflavone |
| − | |Common Name=&&Myricetin 3,3',4'-trimethyl ether && | + | |Common Name=&&Myricetin 3,3',4'-trimethyl ether&&5,7,5'-Trihydroxy-3,3',4'-trimethoxyflavone&& |
|CAS=80368-72-5 | |CAS=80368-72-5 | ||
|KNApSAcK=C00004772 | |KNApSAcK=C00004772 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDK Myricetin O-methyl derivatives (without FL5FAH-FL5FAK, FL5FBG-FL5FBK, FL5FCG-FL5FCK, FL5FDG-FL5FDJ) (6 pages) : FL5FDKNS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 80368-72-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDKNS0001.mol |
| Myricetin 3,3',4'-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,5'-Trihydroxy-3,3',4'-trimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(c(OC)1)(OC)cc(C(O2)=C(C(c(c(O)3)c2cc(O)c3)=O)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
