FL5FEAGL0010
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3-(6"-acetylglucoside) | + | |SysName=3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3- (6"-acetylglucoside) |
| − | |Common Name=&&6-Methoxykaempferol 3-(6"-acetylglucoside)&&3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3-(6"-acetylglucoside)&& | + | |Common Name=&&6-Methoxykaempferol 3- (6"-acetylglucoside) &&3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3- (6"-acetylglucoside) && |
|CAS=118201-25-5 | |CAS=118201-25-5 | ||
|KNApSAcK=C00005935 | |KNApSAcK=C00005935 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEAGL 3-Glucoside and related (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 118201-25-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEAGL0010.mol |
| 6-Methoxykaempferol 3- (6"-acetylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3- (6"-acetylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C24H24O13 |
| Exact Mass | 520.121690854 |
| Average Mass | 520.43956 |
| SMILES | c(c4OC)(O)c(c(cc(O)4)2)C(=O)C(=C(c(c3)ccc(c3)O)O2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
