FL5FEANS0015
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Penduletin | + | |SysName=Penduletin |
|Common Name=&&Penduletin&&5,4'-Dihydroxy-3,6,7-trimethoxyflavone&&5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Penduletin&&5,4'-Dihydroxy-3,6,7-trimethoxyflavone&&5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=569-80-2 | |CAS=569-80-2 | ||
|KNApSAcK=C00004603 | |KNApSAcK=C00004603 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 569-80-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FEANS0015.mol |
Penduletin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Penduletin |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(c3OC)c(O1)c(c(c3OC)O)C(C(=C1c(c2)ccc(O)c2)OC)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |