FL5FECNS0009
From Metabolomics.JP
(Difference between revisions)
| (8 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Axillarin&&3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone | + | |Common Name=&&Axillarin&&3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone&& |
|CAS=5188-73-8 | |CAS=5188-73-8 | ||
|KNApSAcK=C00004684 | |KNApSAcK=C00004684 | ||
}} | }} | ||
Latest revision as of 17:21, 2 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEC Quercetagetin and O-methyl derivatives (150 pages) : FL5FECNS Simple substitution (54 pages) : FL5FECNS0 Normal (44 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 5188-73-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECNS0009.mol |
| Axillarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O8 |
| Exact Mass | 346.068867424 |
| Average Mass | 346.28826 |
| SMILES | COc(c(O)3)c(O)c(C(=O)1)c(c3)OC(c(c2)cc(O)c(O)c2)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
