FL5FECNS0017
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
|Common Name=&&Chrysosplenol D&&5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone&&Quercetagetin 3,6,7-Trimethyl ether&&2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Chrysosplenol D&&5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone&&Quercetagetin 3,6,7-Trimethyl ether&&2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=14965-20-9 | |CAS=14965-20-9 | ||
|KNApSAcK=C00004692 | |KNApSAcK=C00004692 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 14965-20-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FECNS0017.mol |
Chrysosplenol D | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C18H16O8 |
Exact Mass | 360.08451748799996 |
Average Mass | 360.31484 |
SMILES | c(c3OC)c(O1)c(c(c3OC)O)C(C(=C1c(c2)cc(O)c(O)c2)OC) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |