FL5FF9NI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,8-Trihydroxy-3-methoxyflavone 8-((Z)-2-methylbutenoate) | + | |SysName=5,7,8-Trihydroxy-3-methoxyflavone 8- ( (Z) -2-methylbutenoate) |
| − | |Common Name=&&8-Hydroxygalangin 3-methyl ether 8-angelate&&5,7,8-Trihydroxy-3-methoxyflavone 8-((Z)-2-methylbutenoate)&& | + | |Common Name=&&8-Hydroxygalangin 3-methyl ether 8-angelate&&5,7,8-Trihydroxy-3-methoxyflavone 8- ( (Z) -2-methylbutenoate) && |
|CAS=128508-15-6 | |CAS=128508-15-6 | ||
|KNApSAcK=C00004915 | |KNApSAcK=C00004915 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 128508-15-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FF9NI0002.mol |
| 8-Hydroxygalangin 3-methyl ether 8-angelate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8-Trihydroxy-3-methoxyflavone 8- ( (Z) -2-methylbutenoate) |
| Common Name |
|
| Symbol | |
| Formula | C21H18O7 |
| Exact Mass | 382.10525293 |
| Average Mass | 382.36342 |
| SMILES | COC(C3=O)=C(Oc(c23)c(OC(=O)C(C)=CC)c(O)cc2O)c(c1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
