FL5FGCGL0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,4'-Tetrahydroxy-6,8,3'-trimethoxyflavone 3-rhamnosyl-(1->2)-glucoside | |SysName=3,5,7,4'-Tetrahydroxy-6,8,3'-trimethoxyflavone 3-rhamnosyl-(1->2)-glucoside | ||
| − | |Common Name=&&Limocitrol 3-neohesperidoside&& | + | |Common Name=&&Limocitrol 3-neohesperidoside&&3,5,7,4'-Tetrahydroxy-6,8,3'-trimethoxyflavone 3-rhamnosyl-(1->2)-glucoside&& |
|CAS=122327-80-4 | |CAS=122327-80-4 | ||
|KNApSAcK=C00005785 | |KNApSAcK=C00005785 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 122327-80-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGCGL0002.mol |
| Limocitrol 3-neohesperidoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxy-6,8,3'-trimethoxyflavone 3-rhamnosyl-(1->2)-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C30H36O18 |
| Exact Mass | 684.190164348 |
| Average Mass | 684.59604 |
| SMILES | CC([C@@H](O)5)O[C@@H]([C@@H](O)[C@H](O)5)OC(C(O)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
