FL63PTNM0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(+)-8-Hydroxy-5,5-dimethylpeltogynan | + | |SysName= (+) -8-Hydroxy-5,5-dimethylpeltogynan |
− | |Common Name=&&(+)-8-Hydroxy-5,5-dimethylpeltogynan&& | + | |Common Name=&& (+) -8-Hydroxy-5,5-dimethylpeltogynan&& |
|CAS=132125-04-3 | |CAS=132125-04-3 | ||
|KNApSAcK=C00009042 | |KNApSAcK=C00009042 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 132125-04-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL63PTNM0001.mol |
(+) -8-Hydroxy-5,5-dimethylpeltogynan | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (+) -8-Hydroxy-5,5-dimethylpeltogynan |
Common Name |
|
Symbol | |
Formula | C18H18O6 |
Exact Mass | 330.110338308 |
Average Mass | 330.33191999999997 |
SMILES | C(c34)C(O2)C(Oc3cc(O)cc4O)c(c(C2(C)C)1)cc(O)c(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|