FL6F1ANM0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=7,4'-Dihydroxy-8-methylflavan |
|Common Name=&&7,4'-Dihydroxy-8-methylflavan&& | |Common Name=&&7,4'-Dihydroxy-8-methylflavan&& | ||
| − | |CAS=75412-98-5 | + | |CAS=75412-98-5;82925-55-1 |
|KNApSAcK=C00000953 | |KNApSAcK=C00000953 | ||
}} | }} | ||
Latest revision as of 16:07, 9 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6F1A Cassiaflavan and O-methyl derivatives (7 pages) : FL6F1ANM C-Methyl or C2/C3 substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 75412-98-5;82925-55-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6F1ANM0001.mol |
| 7,4'-Dihydroxy-8-methylflavan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,4'-Dihydroxy-8-methylflavan |
| Common Name |
|
| Symbol | |
| Formula | C16H16O3 |
| Exact Mass | 256.109944378 |
| Average Mass | 256.29643999999996 |
| SMILES | Oc(c3)ccc(c3)C([H])(C1)Oc(c(C)2)c(ccc(O)2)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
