FL7ACINS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |SysName=3,5-Dihydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -7-methoxy-1-benzopyrylium  | 
| − | |Common Name=&&Hirsutidin&&  | + | |Common Name=&&Hirsutidin&&3,4',5-Trihydroxy-3',5',7-trimethoxyflavylium&&  | 
|CAS=4092-66-4  | |CAS=4092-66-4  | ||
|KNApSAcK=C00006619  | |KNApSAcK=C00006619  | ||
}}  | }}  | ||
Latest revision as of 16:37, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL7 Anthocyani(di)n : FL7A Anthocyani(di)n : FL7ACI Hirsutidin (3 pages) : FL7ACINS Anthocyanidin (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 4092-66-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL7ACINS0001.mol | 
| Hirsutidin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,5-Dihydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -7-methoxy-1-benzopyrylium | 
| Common Name | 
  | 
| Symbol | |
| Formula | C18H17O7 | 
| Exact Mass | 345.097427898 | 
| Average Mass | 345.32338000000004 | 
| SMILES |  c(c1O)(OC)cc(c([o+1]3)c(O)cc(c32)c(O)cc(OC)c2)cc1O | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
