FLIAAANS0001
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7 | + | |SysName=5,7-Dihydroxy-3- (4-hydroxyphenyl) chromen-4-one |
| − | |Common Name= | + | |Common Name=&&Genistein&&5,7,4'-Trihydroxyisoflavone&&Prunetol&&Sophoricol&&Genisteol&&Differenol A&&Baichanin A&&Bonistein&&Genisterin&& |
| − | |CAS=446-72-0 | + | |CAS=446-72-0;9010-10-0 |
|KNApSAcK=C00002526 | |KNApSAcK=C00002526 | ||
}} | }} | ||
Latest revision as of 15:18, 11 August 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAA Genistein (56 pages) : FLIAAANS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 446-72-0;9010-10-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAAANS0001.mol |
| Genistein | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-3- (4-hydroxyphenyl) chromen-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H10O5 |
| Exact Mass | 270.05282343 |
| Average Mass | 270.2369 |
| SMILES | Oc(c3)ccc(c3)C(=C2)C(=O)c(c(O)1)c(O2)cc(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
