Honokiol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol |Common Name=&&3',5-di-2-Propenyl-[1,1'-biphenyl]-2,4'-diol&&3',5-Diallyl-2,4'-biphenyldio...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol | |SysName=3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol | ||
| − | |Common Name=&&3',5- | + | |Common Name=&&Honokiol&&3',5-Di-2-propenyl-[1,1'-biphenyl]-2,4'-diol&&3',5-Diallyl-2,4'-biphenyldiol&& |
|CAS=35354-74-6 | |CAS=35354-74-6 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 14:01, 12 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 35354-74-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Honokiol.mol |
| Honokiol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol |
| Common Name |
|
| Symbol | |
| Formula | C18H18O2 |
| Exact Mass | 266.13067982 |
| Average Mass | 266.33432 |
| SMILES | C=CCc(c2)cc(c(O)c2)c(c1)cc(CC=C)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
