LBF18203JA02
From Metabolomics.JP
(Difference between revisions)
m (LBF18203OP01 moved to LBF18203JA02) |
|||
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8159 | |LipidBank=DFA8159 |
Latest revision as of 21:33, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8159 |
LipidMaps | LMFA02010001 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18203JA02.mol |
12-oxo-phytodienoic acid | |
---|---|
File:LBF18203JA02.png | |
Structural Information | |
Systematic Name | 4-oxo-5beta- (2Z-pentenyl) -2-cyclopentene-1beta-octanoic acid |
Common Name |
|
Symbol | |
Formula | C18H28O3 |
Exact Mass | 292.203844762 |
Average Mass | 292.41312 |
SMILES | C(CC=CCC)(C(=O)1)C(CCCCCCCC(O)=O)C=C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |