LBF20206HO01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8114 | |LipidBank=DFA8114 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8114 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20206HO01.mol |
![]() | |
Structural Information | |
Systematic Name | 11R-hydroxy-12E,14Z-eicosadienoic acid |
Common Name | |
Symbol | |
Formula | C20H36O3 |
Exact Mass | 324.266445018 |
Average Mass | 324.49804 |
SMILES | C(CC=CC=C[C@@H](CCCCCCCCCC(O)=O)O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 234nm e: 23,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |