LBF20406AM06
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7022 | |LipidBank=XPR7022 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7022 |
| LipidMaps | LMFA08020008 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM06.mol |
| |
| Structural Information | |
| Systematic Name | arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C20H33NO |
| Exact Mass | 303.256214683 |
| Average Mass | 303.48215999999996 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(N)=O)CCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.82 (br s, lH), 5.31-5.42 (m, 8H), 2.79-2.85 (m, 6H), 2.23 (t, J=8.1Hz, 2H), 2.04-2.15 (m, 4H), 1.70-1.77 (m, 2H), 1.25-1.38 (m, 6H), 0.89 (t, J=6.8Hz,3H). <<7001>> |
| Chromatograms | |
