LBF20406AM07
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7023 | |LipidBank=XPR7023 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7023 |
| LipidMaps | LMFA08020009 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM07.mol |
| |
| Structural Information | |
| Systematic Name | N-propylarachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C23H39NO |
| Exact Mass | 345.303164875 |
| Average Mass | 345.5619 |
| SMILES | C(CCC(=O)NCCC)C=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.62 (br s, 1H), 5.26-5.38 (m, 8H), 3.13 (q, J=6Hz, 2H), 2.62-2.80 (m, 6H), 2.10 (t, J=7.3Hz, 2H), 1.96-2.06 (m, 4H), 1.56-1.66 (m, 2H), 1,38-1.48 (m, 2H), 1.20-1.32 (m, 6H), 0.79-0.86 (m, 6H) <<7001>> |
| Chromatograms | |
