LBF20406AM09
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7025 | |LipidBank=XPR7025 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7025 |
LipidMaps | LMFA08020011 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM09.mol |
Structural Information | |
---|---|
Systematic Name | N-butylarachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO |
Exact Mass | 359.318814939 |
Average Mass | 359.58847999999995 |
SMILES | C(=CCCCC(NCCCC)=O)CC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.26-5.44 (m, 8H), 3.24 (q, J=6Hz, 2H), 2.76-2.86 (m, 6H), 2.02-2.22(m, 6H), 1.64-1.78 (m, 2H), 1.22-1.56 (m, 10H), 0.86-0.98 (m, 6H). <<7001>> |
Chromatograms |